4-iodophenylacetic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

p-iodophenylacetic acid; 4-iodophenylacetic acid
Links:📏 NIST
CAS RN:[1798-06-7]
Formula:C8H7IO2; 262.05 g/mol
InChiKey:FJSHTWVDFAUNCO-UHFFFAOYSA-N
SMILES:OC(=O)Cc1ccc(I)cc1
Molecular structure of 4-iodophenylacetic acid
Melting point:138 °C
Log10 partition octanol / water:2.64

Isomers

4'-hydroxy-3'-iodoacetophenone
Molecular structure of 4'-hydroxy-3'-iodoacetophenone
3-iodo-4-methoxybenzaldehyde
Molecular structure of 3-iodo-4-methoxybenzaldehyde
5-iodo-2-methoxybenzaldehyde
Molecular structure of 5-iodo-2-methoxybenzaldehyde
2-iodo-3-methylbenzoic acid
Molecular structure of 2-iodo-3-methylbenzoic acid
3-iodo-4-methylbenzoic acid
Molecular structure of 3-iodo-4-methylbenzoic acid
4-iodo-3-methylbenzoic acid
Molecular structure of 4-iodo-3-methylbenzoic acid
2-iodophenyl acetate
Molecular structure of 2-iodophenyl acetate
3-iodophenyl acetate
Molecular structure of 3-iodophenyl acetate
4-iodophenyl acetate
Molecular structure of 4-iodophenyl acetate
2-iodophenylacetic acid
Molecular structure of 2-iodophenylacetic acid
3-iodophenylacetic acid
Molecular structure of 3-iodophenylacetic acid
4-iodophenylacetic acid
Molecular structure of 4-iodophenylacetic acid
methyl 2-iodobenzoate
Molecular structure of methyl 2-iodobenzoate
methyl 3-iodobenzoate
Molecular structure of methyl 3-iodobenzoate
methyl 4-iodobenzoate
Molecular structure of methyl 4-iodobenzoate
  ::